C27H34F4O4S2 — CID 159843144
1-(4-butoxynaphthalen-1-yl)thiolan-1-ium;2-(1,1,2,2-tetrafluoro-2-oxidoperoxysulfanylethyl)bicyclo[2.2.1]heptane (PubChem CID 159843144) has the molecular formula C27H34F4O4S2 and a molecular weight of 562.69 g/mol. Its IUPAC name is 1-(4-butoxynaphthalen-1-yl)thiolan-1-ium;2-(1,1,2,2-tetrafluoro-2-oxidoperoxysulfanylethyl)bicyclo[2.2.1]heptane.
| Compound Name | 1-(4-butoxynaphthalen-1-yl)thiolan-1-ium;2-(1,1,2,2-tetrafluoro-2-oxidoperoxysulfanylethyl)bicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 159843144 |
| Molecular Formula | C27H34F4O4S2 |
| Molecular Weight | 562.69 g/mol |
| Exact Mass | 562.18 |
| IUPAC Name | 1-(4-butoxynaphthalen-1-yl)thiolan-1-ium;2-(1,1,2,2-tetrafluoro-2-oxidoperoxysulfanylethyl)bicyclo[2.2.1]heptane |
| SMILES | CCCCOc1ccc([S+]2CCCC2)c2ccccc12.[O-]OOSC(F)(F)C(F)(F)C1CC2CCC1C2 |
| InChI | InChI=1S/C18H23OS.C9H12F4O3S/c1-2-3-12-19-17-10-11-18(20-13-6-7-14-20)16-9-5-4-8-15(16)17;10-8(11,9(12,13)17-16-15-14)7-4-5-1-2-6(7)3-5/h4-5,8-11H,2-3,6-7,12-14H2,1H3;5-7,14H,1-4H2/q+1;/p-1 |
| InChIKey | NOYDSBOPSAIAQG-UHFFFAOYSA-M |
| XLogP | 7.31 |
| TPSA | 50.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.69 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|