C15H14F3NO6S3 — CID 140753354
[4-(1,4-oxathian-4-ium-4-yl)naphthalen-1-yl]oxysulfonyl-(trifluoromethylsulfonyl)azanide (PubChem CID 140753354) has the molecular formula C15H14F3NO6S3 and a molecular weight of 457.47 g/mol. Its IUPAC name is [4-(1,4-oxathian-4-ium-4-yl)naphthalen-1-yl]oxysulfonyl-(trifluoromethylsulfonyl)azanide.
| Compound Name | [4-(1,4-oxathian-4-ium-4-yl)naphthalen-1-yl]oxysulfonyl-(trifluoromethylsulfonyl)azanide |
|---|---|
| PubChem CID | 140753354 |
| Molecular Formula | C15H14F3NO6S3 |
| Molecular Weight | 457.47 g/mol |
| Exact Mass | 456.99 |
| IUPAC Name | [4-(1,4-oxathian-4-ium-4-yl)naphthalen-1-yl]oxysulfonyl-(trifluoromethylsulfonyl)azanide |
| SMILES | O=S(=O)([N-]S(=O)(=O)C(F)(F)F)Oc1ccc([S+]2CCOCC2)c2ccccc12 |
| InChI | InChI=1S/C15H14F3NO6S3/c16-15(17,18)27(20,21)19-28(22,23)25-13-5-6-14(26-9-7-24-8-10-26)12-4-2-1-3-11(12)13/h1-6H,7-10H2 |
| InChIKey | AIFNPQRCQJZLPB-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 100.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.47 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|