C20H18F12O7S3 — CID 87649357
1-(4-methoxynaphthalen-1-yl)thiolan-1-ium;1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonic acid;trifluoromethanesulfonate (PubChem CID 87649357) has the molecular formula C20H18F12O7S3 and a molecular weight of 694.53 g/mol. Its IUPAC name is 1-(4-methoxynaphthalen-1-yl)thiolan-1-ium;1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonic acid;trifluoromethanesulfonate.
| Compound Name | 1-(4-methoxynaphthalen-1-yl)thiolan-1-ium;1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonic acid;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 87649357 |
| Molecular Formula | C20H18F12O7S3 |
| Molecular Weight | 694.53 g/mol |
| Exact Mass | 694.00 |
| IUPAC Name | 1-(4-methoxynaphthalen-1-yl)thiolan-1-ium;1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonic acid;trifluoromethanesulfonate |
| SMILES | COc1ccc([S+]2CCCC2)c2ccccc12.O=S(=O)(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C15H17OS.C4HF9O3S.CHF3O3S/c1-16-14-8-9-15(17-10-4-5-11-17)13-7-3-2-6-12(13)14;5-1(6,3(9,10)11)2(7,8)4(12,13)17(14,15)16;2-1(3,4)8(5,6)7/h2-3,6-9H,4-5,10-11H2,1H3;(H,14,15,16);(H,5,6,7)/q+1;;/p-1 |
| InChIKey | VJWDVEFPPYVIMV-UHFFFAOYSA-M |
| XLogP | 5.97 |
| TPSA | 120.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.53 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|