C17H21OS2+ — CID 144582715
1-ethylidene-4-(4-methoxynaphthalen-1-yl)-1,4-dithian-4-ium (PubChem CID 144582715) has the molecular formula C17H21OS2+ and a molecular weight of 305.49 g/mol. Its IUPAC name is 1-ethylidene-4-(4-methoxynaphthalen-1-yl)-1,4-dithian-4-ium.
| Compound Name | 1-ethylidene-4-(4-methoxynaphthalen-1-yl)-1,4-dithian-4-ium |
|---|---|
| PubChem CID | 144582715 |
| Molecular Formula | C17H21OS2+ |
| Molecular Weight | 305.49 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | 1-ethylidene-4-(4-methoxynaphthalen-1-yl)-1,4-dithian-4-ium |
| SMILES | CC=S1CC[S+](c2ccc(OC)c3ccccc23)CC1 |
| InChI | InChI=1S/C17H21OS2/c1-3-19-10-12-20(13-11-19)17-9-8-16(18-2)14-6-4-5-7-15(14)17/h3-9H,10-13H2,1-2H3/q+1 |
| InChIKey | JKVKVTVZQIWXMB-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.49 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|