C16H19O2S+ — CID 88887301
1-(4,8-dimethoxynaphthalen-1-yl)thiolan-1-ium (PubChem CID 88887301) has the molecular formula C16H19O2S+ and a molecular weight of 275.39 g/mol. Its IUPAC name is 1-(4,8-dimethoxynaphthalen-1-yl)thiolan-1-ium.
| Compound Name | 1-(4,8-dimethoxynaphthalen-1-yl)thiolan-1-ium |
|---|---|
| PubChem CID | 88887301 |
| Molecular Formula | C16H19O2S+ |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | 1-(4,8-dimethoxynaphthalen-1-yl)thiolan-1-ium |
| SMILES | COc1ccc([S+]2CCCC2)c2c(OC)cccc12 |
| InChI | InChI=1S/C16H19O2S/c1-17-13-8-9-15(19-10-3-4-11-19)16-12(13)6-5-7-14(16)18-2/h5-9H,3-4,10-11H2,1-2H3/q+1 |
| InChIKey | VPGRFVMBDQTDSB-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|