C14H13F9O3S2 — CID 22605122
1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate;1-phenylthiolan-1-ium (PubChem CID 22605122) has the molecular formula C14H13F9O3S2 and a molecular weight of 464.37 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate;1-phenylthiolan-1-ium.
| Compound Name | 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate;1-phenylthiolan-1-ium |
|---|---|
| PubChem CID | 22605122 |
| Molecular Formula | C14H13F9O3S2 |
| Molecular Weight | 464.37 g/mol |
| Exact Mass | 464.02 |
| IUPAC Name | 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate;1-phenylthiolan-1-ium |
| SMILES | O=S(=O)([O-])C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.c1ccc([S+]2CCCC2)cc1 |
| InChI | InChI=1S/C10H13S.C4HF9O3S/c1-2-6-10(7-3-1)11-8-4-5-9-11;5-1(6,3(9,10)11)2(7,8)4(12,13)17(14,15)16/h1-3,6-7H,4-5,8-9H2;(H,14,15,16)/q+1;/p-1 |
| InChIKey | MARMLDXIXCQJFV-UHFFFAOYSA-M |
| XLogP | 4.41 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.37 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|