C20H21F6O4S+ — CID 140916021
4-[4-[3,3,3-trifluoro-2-(methoxymethoxy)-2-(trifluoromethyl)propoxy]naphthalen-1-yl]-1,4-oxathian-4-ium (PubChem CID 140916021) has the molecular formula C20H21F6O4S+ and a molecular weight of 471.44 g/mol. Its IUPAC name is 4-[4-[3,3,3-trifluoro-2-(methoxymethoxy)-2-(trifluoromethyl)propoxy]naphthalen-1-yl]-1,4-oxathian-4-ium.
| Compound Name | 4-[4-[3,3,3-trifluoro-2-(methoxymethoxy)-2-(trifluoromethyl)propoxy]naphthalen-1-yl]-1,4-oxathian-4-ium |
|---|---|
| PubChem CID | 140916021 |
| Molecular Formula | C20H21F6O4S+ |
| Molecular Weight | 471.44 g/mol |
| Exact Mass | 471.11 |
| IUPAC Name | 4-[4-[3,3,3-trifluoro-2-(methoxymethoxy)-2-(trifluoromethyl)propoxy]naphthalen-1-yl]-1,4-oxathian-4-ium |
| SMILES | COCOC(COc1ccc([S+]2CCOCC2)c2ccccc12)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C20H21F6O4S/c1-27-13-30-18(19(21,22)23,20(24,25)26)12-29-16-6-7-17(31-10-8-28-9-11-31)15-5-3-2-4-14(15)16/h2-7H,8-13H2,1H3/q+1 |
| InChIKey | AEGVPIMMPXPZKG-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.44 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|