C17H19F6O4S+ — CID 140915950
1-[4-[3,3,3-trifluoro-2-(methoxymethoxy)-2-(trifluoromethyl)propoxy]phenyl]thian-1-ium-4-one (PubChem CID 140915950) has the molecular formula C17H19F6O4S+ and a molecular weight of 433.39 g/mol. Its IUPAC name is 1-[4-[3,3,3-trifluoro-2-(methoxymethoxy)-2-(trifluoromethyl)propoxy]phenyl]thian-1-ium-4-one.
| Compound Name | 1-[4-[3,3,3-trifluoro-2-(methoxymethoxy)-2-(trifluoromethyl)propoxy]phenyl]thian-1-ium-4-one |
|---|---|
| PubChem CID | 140915950 |
| Molecular Formula | C17H19F6O4S+ |
| Molecular Weight | 433.39 g/mol |
| Exact Mass | 433.09 |
| IUPAC Name | 1-[4-[3,3,3-trifluoro-2-(methoxymethoxy)-2-(trifluoromethyl)propoxy]phenyl]thian-1-ium-4-one |
| SMILES | COCOC(COc1ccc([S+]2CCC(=O)CC2)cc1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C17H19F6O4S/c1-25-11-27-15(16(18,19)20,17(21,22)23)10-26-13-2-4-14(5-3-13)28-8-6-12(24)7-9-28/h2-5H,6-11H2,1H3/q+1 |
| InChIKey | CTQMSZJWTBLQMT-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.39 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|