C18H21F6O4S+ — CID 160837872
1-[4-[2-ethoxy-3,3,3-trifluoro-2-(trifluoromethyl)propoxy]phenyl]-2-(1,4-oxathian-4-ium-4-yl)ethanone (PubChem CID 160837872) has the molecular formula C18H21F6O4S+ and a molecular weight of 447.42 g/mol. Its IUPAC name is 1-[4-[2-ethoxy-3,3,3-trifluoro-2-(trifluoromethyl)propoxy]phenyl]-2-(1,4-oxathian-4-ium-4-yl)ethanone.
| Compound Name | 1-[4-[2-ethoxy-3,3,3-trifluoro-2-(trifluoromethyl)propoxy]phenyl]-2-(1,4-oxathian-4-ium-4-yl)ethanone |
|---|---|
| PubChem CID | 160837872 |
| Molecular Formula | C18H21F6O4S+ |
| Molecular Weight | 447.42 g/mol |
| Exact Mass | 447.11 |
| IUPAC Name | 1-[4-[2-ethoxy-3,3,3-trifluoro-2-(trifluoromethyl)propoxy]phenyl]-2-(1,4-oxathian-4-ium-4-yl)ethanone |
| SMILES | CCOC(COc1ccc(C(=O)C[S+]2CCOCC2)cc1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C18H21F6O4S/c1-2-28-16(17(19,20)21,18(22,23)24)12-27-14-5-3-13(4-6-14)15(25)11-29-9-7-26-8-10-29/h3-6H,2,7-12H2,1H3/q+1 |
| InChIKey | SREPODQTRQTKQN-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.42 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|