C16H21F3NO7S3+ — CID 140753353
2-[4-[2-(thian-1-ium-1-yl)acetyl]phenoxy]ethyl N-(trifluoromethylsulfonyl)sulfamate (PubChem CID 140753353) has the molecular formula C16H21F3NO7S3+ and a molecular weight of 492.54 g/mol. Its IUPAC name is 2-[4-[2-(thian-1-ium-1-yl)acetyl]phenoxy]ethyl N-(trifluoromethylsulfonyl)sulfamate.
| Compound Name | 2-[4-[2-(thian-1-ium-1-yl)acetyl]phenoxy]ethyl N-(trifluoromethylsulfonyl)sulfamate |
|---|---|
| PubChem CID | 140753353 |
| Molecular Formula | C16H21F3NO7S3+ |
| Molecular Weight | 492.54 g/mol |
| Exact Mass | 492.04 |
| IUPAC Name | 2-[4-[2-(thian-1-ium-1-yl)acetyl]phenoxy]ethyl N-(trifluoromethylsulfonyl)sulfamate |
| SMILES | O=C(C[S+]1CCCCC1)c1ccc(OCCOS(=O)(=O)NS(=O)(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H21F3NO7S3/c17-16(18,19)29(22,23)20-30(24,25)27-9-8-26-14-6-4-13(5-7-14)15(21)12-28-10-2-1-3-11-28/h4-7,20H,1-3,8-12H2/q+1 |
| InChIKey | KILVMFNIBJIZLI-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 115.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.54 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|