C18H25F3NO6S3+ — CID 140753253
[4-[4-(thian-1-ium-1-yl)phenoxy]cyclohexyl] N-(trifluoromethylsulfonyl)sulfamate (PubChem CID 140753253) has the molecular formula C18H25F3NO6S3+ and a molecular weight of 504.59 g/mol. Its IUPAC name is [4-[4-(thian-1-ium-1-yl)phenoxy]cyclohexyl] N-(trifluoromethylsulfonyl)sulfamate.
| Compound Name | [4-[4-(thian-1-ium-1-yl)phenoxy]cyclohexyl] N-(trifluoromethylsulfonyl)sulfamate |
|---|---|
| PubChem CID | 140753253 |
| Molecular Formula | C18H25F3NO6S3+ |
| Molecular Weight | 504.59 g/mol |
| Exact Mass | 504.08 |
| IUPAC Name | [4-[4-(thian-1-ium-1-yl)phenoxy]cyclohexyl] N-(trifluoromethylsulfonyl)sulfamate |
| SMILES | O=S(=O)(NS(=O)(=O)C(F)(F)F)OC1CCC(Oc2ccc([S+]3CCCCC3)cc2)CC1 |
| InChI | InChI=1S/C18H25F3NO6S3/c19-18(20,21)30(23,24)22-31(25,26)28-16-6-4-14(5-7-16)27-15-8-10-17(11-9-15)29-12-2-1-3-13-29/h8-11,14,16,22H,1-7,12-13H2/q+1 |
| InChIKey | XRWDCBTZYBBZMC-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.59 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|