C11H16F3NO5S2 — CID 122661154
2-adamantyl N-(trifluoromethylsulfonyl)sulfamate (PubChem CID 122661154) has the molecular formula C11H16F3NO5S2 and a molecular weight of 363.38 g/mol. Its IUPAC name is 2-adamantyl N-(trifluoromethylsulfonyl)sulfamate.
| Compound Name | 2-adamantyl N-(trifluoromethylsulfonyl)sulfamate |
|---|---|
| PubChem CID | 122661154 |
| Molecular Formula | C11H16F3NO5S2 |
| Molecular Weight | 363.38 g/mol |
| Exact Mass | 363.04 |
| IUPAC Name | 2-adamantyl N-(trifluoromethylsulfonyl)sulfamate |
| SMILES | O=S(=O)(NS(=O)(=O)C(F)(F)F)OC1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C11H16F3NO5S2/c12-11(13,14)21(16,17)15-22(18,19)20-10-8-2-6-1-7(4-8)5-9(10)3-6/h6-10,15H,1-5H2 |
| InChIKey | BIOZDABBKVXATG-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.38 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |