C13H18F2O5S — CID 175071168
methyl 2-(2-adamantyloxysulfonyl)-2,2-difluoroacetate (PubChem CID 175071168) has the molecular formula C13H18F2O5S and a molecular weight of 324.35 g/mol. Its IUPAC name is methyl 2-(2-adamantyloxysulfonyl)-2,2-difluoroacetate.
| Compound Name | methyl 2-(2-adamantyloxysulfonyl)-2,2-difluoroacetate |
|---|---|
| PubChem CID | 175071168 |
| Molecular Formula | C13H18F2O5S |
| Molecular Weight | 324.35 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | methyl 2-(2-adamantyloxysulfonyl)-2,2-difluoroacetate |
| SMILES | COC(=O)C(F)(F)S(=O)(=O)OC1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C13H18F2O5S/c1-19-12(16)13(14,15)21(17,18)20-11-9-3-7-2-8(5-9)6-10(11)4-7/h7-11H,2-6H2,1H3 |
| InChIKey | ORWOHUONRNHQMK-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.35 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|