C15H16F6O4 — CID 164747747
5-(2-adamantyloxy)-2,2,3,3,4,4-hexafluoro-5-oxopentanoic acid (PubChem CID 164747747) has the molecular formula C15H16F6O4 and a molecular weight of 374.28 g/mol. Its IUPAC name is 5-(2-adamantyloxy)-2,2,3,3,4,4-hexafluoro-5-oxopentanoic acid.
| Compound Name | 5-(2-adamantyloxy)-2,2,3,3,4,4-hexafluoro-5-oxopentanoic acid |
|---|---|
| PubChem CID | 164747747 |
| Molecular Formula | C15H16F6O4 |
| Molecular Weight | 374.28 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | 5-(2-adamantyloxy)-2,2,3,3,4,4-hexafluoro-5-oxopentanoic acid |
| SMILES | O=C(O)C(F)(F)C(F)(F)C(F)(F)C(=O)OC1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C15H16F6O4/c16-13(17,11(22)23)15(20,21)14(18,19)12(24)25-10-8-2-6-1-7(4-8)5-9(10)3-6/h6-10H,1-5H2,(H,22,23) |
| InChIKey | UQIISEIXDZZWDJ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.28 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|