C16H22O7 — CID 175096212
2-[2-(2-adamantyloxy)-2-oxoethyl]-2-hydroxybutanedioic acid (PubChem CID 175096212) has the molecular formula C16H22O7 and a molecular weight of 326.35 g/mol. Its IUPAC name is 2-[2-(2-adamantyloxy)-2-oxoethyl]-2-hydroxybutanedioic acid.
| Compound Name | 2-[2-(2-adamantyloxy)-2-oxoethyl]-2-hydroxybutanedioic acid |
|---|---|
| PubChem CID | 175096212 |
| Molecular Formula | C16H22O7 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | 2-[2-(2-adamantyloxy)-2-oxoethyl]-2-hydroxybutanedioic acid |
| SMILES | O=C(O)CC(O)(CC(=O)OC1C2CC3CC(C2)CC1C3)C(=O)O |
| InChI | InChI=1S/C16H22O7/c17-12(18)6-16(22,15(20)21)7-13(19)23-14-10-2-8-1-9(4-10)5-11(14)3-8/h8-11,14,22H,1-7H2,(H,17,18)(H,20,21) |
| InChIKey | FGYAQFVTAIISDV-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |