C6H8LaO8 — CID 87975586
2-(2-hydroperoxy-2-oxoethyl)-2-hydroxybutanedioic acid;lanthanum (PubChem CID 87975586) has the molecular formula C6H8LaO8 and a molecular weight of 347.03 g/mol. Its IUPAC name is 2-(2-hydroperoxy-2-oxoethyl)-2-hydroxybutanedioic acid;lanthanum.
| Compound Name | 2-(2-hydroperoxy-2-oxoethyl)-2-hydroxybutanedioic acid;lanthanum |
|---|---|
| PubChem CID | 87975586 |
| Molecular Formula | C6H8LaO8 |
| Molecular Weight | 347.03 g/mol |
| Exact Mass | 346.93 |
| IUPAC Name | 2-(2-hydroperoxy-2-oxoethyl)-2-hydroxybutanedioic acid;lanthanum |
| SMILES | O=C(O)CC(O)(CC(=O)OO)C(=O)O.[La] |
| InChI | InChI=1S/C6H8O8.La/c7-3(8)1-6(12,5(10)11)2-4(9)14-13;/h12-13H,1-2H2,(H,7,8)(H,10,11); |
| InChIKey | RXCCBYSUXBAOKF-UHFFFAOYSA-N |
| XLogP | -1.32 |
| TPSA | 141.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.03 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|