C6H9KO8 — CID 173087123
potassium;hydride;2-(2-hydroperoxy-2-oxoethyl)-2-hydroxybutanedioic acid (PubChem CID 173087123) has the molecular formula C6H9KO8 and a molecular weight of 248.23 g/mol. Its IUPAC name is potassium;hydride;2-(2-hydroperoxy-2-oxoethyl)-2-hydroxybutanedioic acid.
| Compound Name | potassium;hydride;2-(2-hydroperoxy-2-oxoethyl)-2-hydroxybutanedioic acid |
|---|---|
| PubChem CID | 173087123 |
| Molecular Formula | C6H9KO8 |
| Molecular Weight | 248.23 g/mol |
| Exact Mass | 247.99 |
| IUPAC Name | potassium;hydride;2-(2-hydroperoxy-2-oxoethyl)-2-hydroxybutanedioic acid |
| SMILES | O=C(O)CC(O)(CC(=O)OO)C(=O)O.[H-].[K+] |
| InChI | InChI=1S/C6H8O8.K.H/c7-3(8)1-6(12,5(10)11)2-4(9)14-13;;/h12-13H,1-2H2,(H,7,8)(H,10,11);;/q;+1;-1 |
| InChIKey | CPYJLKRSZVSNBU-UHFFFAOYSA-N |
| XLogP | -4.20 |
| TPSA | 141.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.23 |
| LogP ≤ 5 | -4.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|