C6H8BiKO7+4 — CID 170923205
bismuth;potassium;2-hydroxypropane-1,2,3-tricarboxylic acid (PubChem CID 170923205) has the molecular formula C6H8BiKO7+4 and a molecular weight of 440.20 g/mol. Its IUPAC name is bismuth;potassium;2-hydroxypropane-1,2,3-tricarboxylic acid.
| Compound Name | bismuth;potassium;2-hydroxypropane-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 170923205 |
| Molecular Formula | C6H8BiKO7+4 |
| Molecular Weight | 440.20 g/mol |
| Exact Mass | 439.97 |
| IUPAC Name | bismuth;potassium;2-hydroxypropane-1,2,3-tricarboxylic acid |
| SMILES | O=C(O)CC(O)(CC(=O)O)C(=O)O.[Bi+3].[K+] |
| InChI | InChI=1S/C6H8O7.Bi.K/c7-3(8)1-6(13,5(11)12)2-4(9)10;;/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);;/q;+3;+1 |
| InChIKey | KZFDVWZZYOPBQZ-UHFFFAOYSA-N |
| XLogP | -4.63 |
| TPSA | 132.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.20 |
| LogP ≤ 5 | -4.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |