C11H17NO7 — CID 174892383
2-hydroxy-2-(2-oxo-2-piperidin-4-yloxyethyl)butanedioic acid (PubChem CID 174892383) has the molecular formula C11H17NO7 and a molecular weight of 275.26 g/mol. Its IUPAC name is 2-hydroxy-2-(2-oxo-2-piperidin-4-yloxyethyl)butanedioic acid.
| Compound Name | 2-hydroxy-2-(2-oxo-2-piperidin-4-yloxyethyl)butanedioic acid |
|---|---|
| PubChem CID | 174892383 |
| Molecular Formula | C11H17NO7 |
| Molecular Weight | 275.26 g/mol |
| Exact Mass | 275.10 |
| IUPAC Name | 2-hydroxy-2-(2-oxo-2-piperidin-4-yloxyethyl)butanedioic acid |
| SMILES | O=C(O)CC(O)(CC(=O)OC1CCNCC1)C(=O)O |
| InChI | InChI=1S/C11H17NO7/c13-8(14)5-11(18,10(16)17)6-9(15)19-7-1-3-12-4-2-7/h7,12,18H,1-6H2,(H,13,14)(H,16,17) |
| InChIKey | ZEHHBGCLMFNLDT-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 133.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.26 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |