C10H18N2O8 — CID 175295046
2-hydroxy-2-(2-oxo-2-piperazin-1-yloxyethyl)butanedioic acid;hydrate (PubChem CID 175295046) has the molecular formula C10H18N2O8 and a molecular weight of 294.26 g/mol. Its IUPAC name is 2-hydroxy-2-(2-oxo-2-piperazin-1-yloxyethyl)butanedioic acid;hydrate.
| Compound Name | 2-hydroxy-2-(2-oxo-2-piperazin-1-yloxyethyl)butanedioic acid;hydrate |
|---|---|
| PubChem CID | 175295046 |
| Molecular Formula | C10H18N2O8 |
| Molecular Weight | 294.26 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | 2-hydroxy-2-(2-oxo-2-piperazin-1-yloxyethyl)butanedioic acid;hydrate |
| SMILES | O.O=C(O)CC(O)(CC(=O)ON1CCNCC1)C(=O)O |
| InChI | InChI=1S/C10H16N2O7.H2O/c13-7(14)5-10(18,9(16)17)6-8(15)19-12-3-1-11-2-4-12;/h11,18H,1-6H2,(H,13,14)(H,16,17);1H2 |
| InChIKey | ZVZPTZNQLVVZEG-UHFFFAOYSA-N |
| XLogP | -2.79 |
| TPSA | 167.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.26 |
| LogP ≤ 5 | -2.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |