About piperidin-4-yl pentanoate
piperidin-4-yl pentanoate (PubChem CID 45091374) has the molecular formula C10H19NO2
and a molecular weight of 185.27 g/mol. Its IUPAC name is piperidin-4-yl pentanoate.
Molecular Properties
| Compound Name | piperidin-4-yl pentanoate |
| PubChem CID | 45091374 |
| Molecular Formula | C10H19NO2 |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.14 |
| IUPAC Name | piperidin-4-yl pentanoate |
| SMILES | CCCCC(=O)OC1CCNCC1 |
| InChI | InChI=1S/C10H19NO2/c1-2-3-4-10(12)13-9-5-7-11-8-6-9/h9,11H,2-8H2,1H3 |
| InChIKey | QISQNBJNJNBVRU-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze piperidin-4-yl pentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of piperidin-4-yl pentanoate?
The IUPAC name of piperidin-4-yl pentanoate (CID 45091374) is piperidin-4-yl pentanoate.
What is the SMILES notation for piperidin-4-yl pentanoate?
The canonical SMILES for piperidin-4-yl pentanoate is CCCCC(=O)OC1CCNCC1.
What is the InChIKey of piperidin-4-yl pentanoate?
The InChIKey is QISQNBJNJNBVRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO2/c1-2-3-4-10(12)13-9-5-7-11-8-6-9/h9,11H,2-8H2,1H3.
What are the key properties of piperidin-4-yl pentanoate?
piperidin-4-yl pentanoate has a molecular weight of 185.27 g/mol, XLogP of 1.47, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for piperidin-4-yl pentanoate is sourced from PubChem (CID 45091374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).