C12H19LiO7 — CID 175408310
lithium;2-(2-cyclohexyloxy-2-oxoethyl)-2-hydroxybutanedioic acid;hydride (PubChem CID 175408310) has the molecular formula C12H19LiO7 and a molecular weight of 282.22 g/mol. Its IUPAC name is lithium;2-(2-cyclohexyloxy-2-oxoethyl)-2-hydroxybutanedioic acid;hydride.
| Compound Name | lithium;2-(2-cyclohexyloxy-2-oxoethyl)-2-hydroxybutanedioic acid;hydride |
|---|---|
| PubChem CID | 175408310 |
| Molecular Formula | C12H19LiO7 |
| Molecular Weight | 282.22 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | lithium;2-(2-cyclohexyloxy-2-oxoethyl)-2-hydroxybutanedioic acid;hydride |
| SMILES | O=C(O)CC(O)(CC(=O)OC1CCCCC1)C(=O)O.[H-].[Li+] |
| InChI | InChI=1S/C12H18O7.Li.H/c13-9(14)6-12(18,11(16)17)7-10(15)19-8-4-2-1-3-5-8;;/h8,18H,1-7H2,(H,13,14)(H,16,17);;/q;+1;-1 |
| InChIKey | GFGXVSQEVDFHAE-UHFFFAOYSA-N |
| XLogP | -2.34 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.22 |
| LogP ≤ 5 | -2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |