C23H28N2O4 — CID 67820005
2-(2-adamantyloxycarbonyl)-2-amino-3-(1H-indol-3-yl)butanoic acid (PubChem CID 67820005) has the molecular formula C23H28N2O4 and a molecular weight of 396.49 g/mol. Its IUPAC name is 2-(2-adamantyloxycarbonyl)-2-amino-3-(1H-indol-3-yl)butanoic acid.
| Compound Name | 2-(2-adamantyloxycarbonyl)-2-amino-3-(1H-indol-3-yl)butanoic acid |
|---|---|
| PubChem CID | 67820005 |
| Molecular Formula | C23H28N2O4 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | 2-(2-adamantyloxycarbonyl)-2-amino-3-(1H-indol-3-yl)butanoic acid |
| SMILES | CC(c1c[nH]c2ccccc12)C(N)(C(=O)O)C(=O)OC1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C23H28N2O4/c1-12(18-11-25-19-5-3-2-4-17(18)19)23(24,21(26)27)22(28)29-20-15-7-13-6-14(9-15)10-16(20)8-13/h2-5,11-16,20,25H,6-10,24H2,1H3,(H,26,27) |
| InChIKey | BXULJPDZNREZCU-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 105.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|