C21H19F3N2O4 — CID 122214280
dimethyl 2-amino-2-[(S)-1H-indol-3-yl-[4-(trifluoromethyl)phenyl]methyl]propanedioate (PubChem CID 122214280) has the molecular formula C21H19F3N2O4 and a molecular weight of 420.39 g/mol. Its IUPAC name is dimethyl 2-amino-2-[(S)-1H-indol-3-yl-[4-(trifluoromethyl)phenyl]methyl]propanedioate.
| Compound Name | dimethyl 2-amino-2-[(S)-1H-indol-3-yl-[4-(trifluoromethyl)phenyl]methyl]propanedioate |
|---|---|
| PubChem CID | 122214280 |
| Molecular Formula | C21H19F3N2O4 |
| Molecular Weight | 420.39 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | dimethyl 2-amino-2-[(S)-1H-indol-3-yl-[4-(trifluoromethyl)phenyl]methyl]propanedioate |
| SMILES | COC(=O)C(N)(C(=O)OC)[C@@H](c1ccc(C(F)(F)F)cc1)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C21H19F3N2O4/c1-29-18(27)20(25,19(28)30-2)17(12-7-9-13(10-8-12)21(22,23)24)15-11-26-16-6-4-3-5-14(15)16/h3-11,17,26H,25H2,1-2H3/t17-/m0/s1 |
| InChIKey | IWFAEKSHUVYXNP-KRWDZBQOSA-N |
| XLogP | 3.36 |
| TPSA | 94.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.39 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|