About 2-adamantyl carbonochloridate
2-adamantyl carbonochloridate (PubChem CID 10878537) has the molecular formula C11H15ClO2
and a molecular weight of 214.69 g/mol. Its IUPAC name is 2-adamantyl carbonochloridate.
Molecular Properties
| Compound Name | 2-adamantyl carbonochloridate |
| PubChem CID | 10878537 |
| Molecular Formula | C11H15ClO2 |
| Molecular Weight | 214.69 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | 2-adamantyl carbonochloridate |
| SMILES | O=C(Cl)OC1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C11H15ClO2/c12-11(13)14-10-8-2-6-1-7(4-8)5-9(10)3-6/h6-10H,1-5H2 |
| InChIKey | WUVZDJSSAGWPIE-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.69 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-adamantyl carbonochloridate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-adamantyl carbonochloridate?
The IUPAC name of 2-adamantyl carbonochloridate (CID 10878537) is 2-adamantyl carbonochloridate.
What is the SMILES notation for 2-adamantyl carbonochloridate?
The canonical SMILES for 2-adamantyl carbonochloridate is O=C(Cl)OC1C2CC3CC(C2)CC1C3.
What is the InChIKey of 2-adamantyl carbonochloridate?
The InChIKey is WUVZDJSSAGWPIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15ClO2/c12-11(13)14-10-8-2-6-1-7(4-8)5-9(10)3-6/h6-10H,1-5H2.
What are the key properties of 2-adamantyl carbonochloridate?
2-adamantyl carbonochloridate has a molecular weight of 214.69 g/mol, XLogP of 3.19, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-adamantyl carbonochloridate is sourced from PubChem (CID 10878537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).