About 2-adamantyloxy carbonochloridate
2-adamantyloxy carbonochloridate (PubChem CID 22417249) has the molecular formula C11H15ClO3
and a molecular weight of 230.69 g/mol. Its IUPAC name is 2-adamantyloxy carbonochloridate.
Molecular Properties
| Compound Name | 2-adamantyloxy carbonochloridate |
| PubChem CID | 22417249 |
| Molecular Formula | C11H15ClO3 |
| Molecular Weight | 230.69 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | 2-adamantyloxy carbonochloridate |
| SMILES | O=C(Cl)OOC1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C11H15ClO3/c12-11(13)15-14-10-8-2-6-1-7(4-8)5-9(10)3-6/h6-10H,1-5H2 |
| InChIKey | CLECJZXNADHFRY-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.69 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 2-adamantyloxy carbonochloridate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-adamantyloxy carbonochloridate?
The IUPAC name of 2-adamantyloxy carbonochloridate (CID 22417249) is 2-adamantyloxy carbonochloridate.
What is the SMILES notation for 2-adamantyloxy carbonochloridate?
The canonical SMILES for 2-adamantyloxy carbonochloridate is O=C(Cl)OOC1C2CC3CC(C2)CC1C3.
What is the InChIKey of 2-adamantyloxy carbonochloridate?
The InChIKey is CLECJZXNADHFRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15ClO3/c12-11(13)15-14-10-8-2-6-1-7(4-8)5-9(10)3-6/h6-10H,1-5H2.
What are the key properties of 2-adamantyloxy carbonochloridate?
2-adamantyloxy carbonochloridate has a molecular weight of 230.69 g/mol, XLogP of 3.12, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-adamantyloxy carbonochloridate is sourced from PubChem (CID 22417249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).