About adamantane;urea
adamantane;urea (PubChem CID 68761520) has the molecular formula C11H20N2O
and a molecular weight of 196.29 g/mol. Its IUPAC name is adamantane;urea.
Molecular Properties
| Compound Name | adamantane;urea |
| PubChem CID | 68761520 |
| Molecular Formula | C11H20N2O |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.16 |
| IUPAC Name | adamantane;urea |
| SMILES | C1C2CC3CC1CC(C2)C3.NC(N)=O |
| InChI | InChI=1S/C10H16.CH4N2O/c1-7-2-9-4-8(1)5-10(3-7)6-9;2-1(3)4/h7-10H,1-6H2;(H4,2,3,4) |
| InChIKey | MWFBNPVTFPRUHI-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze adamantane;urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of adamantane;urea?
The IUPAC name of adamantane;urea (CID 68761520) is adamantane;urea.
What is the SMILES notation for adamantane;urea?
The canonical SMILES for adamantane;urea is C1C2CC3CC1CC(C2)C3.NC(N)=O.
What is the InChIKey of adamantane;urea?
The InChIKey is MWFBNPVTFPRUHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16.CH4N2O/c1-7-2-9-4-8(1)5-10(3-7)6-9;2-1(3)4/h7-10H,1-6H2;(H4,2,3,4).
What are the key properties of adamantane;urea?
adamantane;urea has a molecular weight of 196.29 g/mol, XLogP of 1.86, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for adamantane;urea is sourced from PubChem (CID 68761520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).