C14H20F4NO6S2- — CID 140750763
2-adamantyloxysulfonyl-(1,1,2,2-tetrafluoro-4-hydroxybutyl)sulfonylazanide (PubChem CID 140750763) has the molecular formula C14H20F4NO6S2- and a molecular weight of 438.44 g/mol. Its IUPAC name is 2-adamantyloxysulfonyl-(1,1,2,2-tetrafluoro-4-hydroxybutyl)sulfonylazanide.
| Compound Name | 2-adamantyloxysulfonyl-(1,1,2,2-tetrafluoro-4-hydroxybutyl)sulfonylazanide |
|---|---|
| PubChem CID | 140750763 |
| Molecular Formula | C14H20F4NO6S2- |
| Molecular Weight | 438.44 g/mol |
| Exact Mass | 438.07 |
| IUPAC Name | 2-adamantyloxysulfonyl-(1,1,2,2-tetrafluoro-4-hydroxybutyl)sulfonylazanide |
| SMILES | O=S(=O)([N-]S(=O)(=O)C(F)(F)C(F)(F)CCO)OC1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C14H20F4NO6S2/c15-13(16,1-2-20)14(17,18)26(21,22)19-27(23,24)25-12-10-4-8-3-9(6-10)7-11(12)5-8/h8-12,20H,1-7H2/q-1 |
| InChIKey | MOMGTZDODUCZEX-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 111.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.44 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|