C16H24F2NO8S3- — CID 140750687
2-adamantyloxysulfonyl-[cyclopentyloxysulfonyl(difluoro)methyl]sulfonylazanide (PubChem CID 140750687) has the molecular formula C16H24F2NO8S3- and a molecular weight of 492.56 g/mol. Its IUPAC name is 2-adamantyloxysulfonyl-[cyclopentyloxysulfonyl(difluoro)methyl]sulfonylazanide.
| Compound Name | 2-adamantyloxysulfonyl-[cyclopentyloxysulfonyl(difluoro)methyl]sulfonylazanide |
|---|---|
| PubChem CID | 140750687 |
| Molecular Formula | C16H24F2NO8S3- |
| Molecular Weight | 492.56 g/mol |
| Exact Mass | 492.06 |
| IUPAC Name | 2-adamantyloxysulfonyl-[cyclopentyloxysulfonyl(difluoro)methyl]sulfonylazanide |
| SMILES | O=S(=O)([N-]S(=O)(=O)C(F)(F)S(=O)(=O)OC1CCCC1)OC1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C16H24F2NO8S3/c17-16(18,29(22,23)26-14-3-1-2-4-14)28(20,21)19-30(24,25)27-15-12-6-10-5-11(8-12)9-13(15)7-10/h10-15H,1-9H2/q-1 |
| InChIKey | OHGLLPKIQQASKA-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 134.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.56 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|