C18H23F6N2O6S2- — CID 140750729
[4-(dimethylamino)-1,1,2,2,3,3-hexafluoro-4-oxobutyl]sulfonyl-(4-tetracyclo[6.2.1.13,6.02,7]dodecanyloxysulfonyl)azanide (PubChem CID 140750729) has the molecular formula C18H23F6N2O6S2- and a molecular weight of 541.51 g/mol. Its IUPAC name is [4-(dimethylamino)-1,1,2,2,3,3-hexafluoro-4-oxobutyl]sulfonyl-(4-tetracyclo[6.2.1.13,6.02,7]dodecanyloxysulfonyl)azanide.
| Compound Name | [4-(dimethylamino)-1,1,2,2,3,3-hexafluoro-4-oxobutyl]sulfonyl-(4-tetracyclo[6.2.1.13,6.02,7]dodecanyloxysulfonyl)azanide |
|---|---|
| PubChem CID | 140750729 |
| Molecular Formula | C18H23F6N2O6S2- |
| Molecular Weight | 541.51 g/mol |
| Exact Mass | 541.09 |
| IUPAC Name | [4-(dimethylamino)-1,1,2,2,3,3-hexafluoro-4-oxobutyl]sulfonyl-(4-tetracyclo[6.2.1.13,6.02,7]dodecanyloxysulfonyl)azanide |
| SMILES | CN(C)C(=O)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)[N-]S(=O)(=O)OC1CC2CC1C1C3CCC(C3)C21 |
| InChI | InChI=1S/C18H23F6N2O6S2/c1-26(2)15(27)16(19,20)17(21,22)18(23,24)33(28,29)25-34(30,31)32-12-7-10-6-11(12)14-9-4-3-8(5-9)13(10)14/h8-14H,3-7H2,1-2H3/q-1 |
| InChIKey | FOARNRGJQUYARD-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 111.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.51 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|