C19H32O3 — CID 143448489
propane;1-(4-tetracyclo[6.2.1.13,6.02,7]dodecanyloxy)ethyl acetate (PubChem CID 143448489) has the molecular formula C19H32O3 and a molecular weight of 308.46 g/mol. Its IUPAC name is propane;1-(4-tetracyclo[6.2.1.13,6.02,7]dodecanyloxy)ethyl acetate.
| Compound Name | propane;1-(4-tetracyclo[6.2.1.13,6.02,7]dodecanyloxy)ethyl acetate |
|---|---|
| PubChem CID | 143448489 |
| Molecular Formula | C19H32O3 |
| Molecular Weight | 308.46 g/mol |
| Exact Mass | 308.24 |
| IUPAC Name | propane;1-(4-tetracyclo[6.2.1.13,6.02,7]dodecanyloxy)ethyl acetate |
| SMILES | CC(=O)OC(C)OC1CC2CC1C1C3CCC(C3)C21.CCC |
| InChI | InChI=1S/C16H24O3.C3H8/c1-8(17)18-9(2)19-14-7-12-6-13(14)16-11-4-3-10(5-11)15(12)16;1-3-2/h9-16H,3-7H2,1-2H3;3H2,1-2H3 |
| InChIKey | FECVETNUKPGESO-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.46 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|