C15H18F4O5S — CID 58881595
4-tetracyclo[6.2.1.13,6.02,7]dodecanyl 2,3,3,3-tetrafluoro-2-(trioxidanylsulfanyl)propanoate (PubChem CID 58881595) has the molecular formula C15H18F4O5S and a molecular weight of 386.36 g/mol. Its IUPAC name is 4-tetracyclo[6.2.1.13,6.02,7]dodecanyl 2,3,3,3-tetrafluoro-2-(trioxidanylsulfanyl)propanoate.
| Compound Name | 4-tetracyclo[6.2.1.13,6.02,7]dodecanyl 2,3,3,3-tetrafluoro-2-(trioxidanylsulfanyl)propanoate |
|---|---|
| PubChem CID | 58881595 |
| Molecular Formula | C15H18F4O5S |
| Molecular Weight | 386.36 g/mol |
| Exact Mass | 386.08 |
| IUPAC Name | 4-tetracyclo[6.2.1.13,6.02,7]dodecanyl 2,3,3,3-tetrafluoro-2-(trioxidanylsulfanyl)propanoate |
| SMILES | O=C(OC1CC2CC1C1C3CCC(C3)C21)C(F)(SOOO)C(F)(F)F |
| InChI | InChI=1S/C15H18F4O5S/c16-14(15(17,18)19,25-24-23-21)13(20)22-10-5-8-4-9(10)12-7-2-1-6(3-7)11(8)12/h6-12,21H,1-5H2 |
| InChIKey | XSGHIRBTSRWVFP-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.36 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|