C11H16F2O5S — CID 58021748
[5-[2,2-difluoro-2-(trioxidanylsulfanyl)ethyl]-2-bicyclo[2.2.1]heptanyl] acetate (PubChem CID 58021748) has the molecular formula C11H16F2O5S and a molecular weight of 298.31 g/mol. Its IUPAC name is [5-[2,2-difluoro-2-(trioxidanylsulfanyl)ethyl]-2-bicyclo[2.2.1]heptanyl] acetate.
| Compound Name | [5-[2,2-difluoro-2-(trioxidanylsulfanyl)ethyl]-2-bicyclo[2.2.1]heptanyl] acetate |
|---|---|
| PubChem CID | 58021748 |
| Molecular Formula | C11H16F2O5S |
| Molecular Weight | 298.31 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | [5-[2,2-difluoro-2-(trioxidanylsulfanyl)ethyl]-2-bicyclo[2.2.1]heptanyl] acetate |
| SMILES | CC(=O)OC1CC2CC1CC2CC(F)(F)SOOO |
| InChI | InChI=1S/C11H16F2O5S/c1-6(14)16-10-4-7-2-8(10)3-9(7)5-11(12,13)19-18-17-15/h7-10,15H,2-5H2,1H3 |
| InChIKey | RKRJWGSYRAAJMR-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.31 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|