C4ClF10MgNO4S2 — CID 140785394
magnesium;bis(1,1,2,2,2-pentafluoroethylsulfonyl)azanide;chloride (PubChem CID 140785394) has the molecular formula C4ClF10MgNO4S2 and a molecular weight of 439.92 g/mol. Its IUPAC name is magnesium;bis(1,1,2,2,2-pentafluoroethylsulfonyl)azanide;chloride.
| Compound Name | magnesium;bis(1,1,2,2,2-pentafluoroethylsulfonyl)azanide;chloride |
|---|---|
| PubChem CID | 140785394 |
| Molecular Formula | C4ClF10MgNO4S2 |
| Molecular Weight | 439.92 g/mol |
| Exact Mass | 438.86 |
| IUPAC Name | magnesium;bis(1,1,2,2,2-pentafluoroethylsulfonyl)azanide;chloride |
| SMILES | O=S(=O)([N-]S(=O)(=O)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)F.[Cl-].[Mg+2] |
| InChI | InChI=1S/C4F10NO4S2.ClH.Mg/c5-1(6,7)3(11,12)20(16,17)15-21(18,19)4(13,14)2(8,9)10;;/h;1H;/q-1;;+2/p-1 |
| InChIKey | BNIVNPKWZLRCBY-UHFFFAOYSA-M |
| XLogP | -1.05 |
| TPSA | 82.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.92 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|