C4F10NNaO4S2 — CID 87423860
sodium bis(1,1,2,2,2-pentafluoroethylsulfonyl)azanide (PubChem CID 87423860) has the molecular formula C4F10NNaO4S2 and a molecular weight of 403.15 g/mol. Its IUPAC name is sodium bis(1,1,2,2,2-pentafluoroethylsulfonyl)azanide.
| Compound Name | sodium bis(1,1,2,2,2-pentafluoroethylsulfonyl)azanide |
|---|---|
| PubChem CID | 87423860 |
| Molecular Formula | C4F10NNaO4S2 |
| Molecular Weight | 403.15 g/mol |
| Exact Mass | 402.90 |
| IUPAC Name | sodium bis(1,1,2,2,2-pentafluoroethylsulfonyl)azanide |
| SMILES | O=S(=O)([N-]S(=O)(=O)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)F.[Na+] |
| InChI | InChI=1S/C4F10NO4S2.Na/c5-1(6,7)3(11,12)20(16,17)15-21(18,19)4(13,14)2(8,9)10;/q-1;+1 |
| InChIKey | QSTITLHDMBEKHE-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 82.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.15 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|