C16CuF36N2O8S4 — CID 25185926
copper bis(bis(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)azanide) (PubChem CID 25185926) has the molecular formula C16CuF36N2O8S4 and a molecular weight of 1223.92 g/mol. Its IUPAC name is copper bis(bis(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)azanide).
| Compound Name | copper bis(bis(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)azanide) |
|---|---|
| PubChem CID | 25185926 |
| Molecular Formula | C16CuF36N2O8S4 |
| Molecular Weight | 1223.92 g/mol |
| Exact Mass | 1222.73 |
| IUPAC Name | copper bis(bis(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)azanide) |
| SMILES | O=S(=O)([N-]S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.O=S(=O)([N-]S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.[Cu+2] |
| InChI | InChI=1S/2C8F18NO4S2.Cu/c2*9-1(10,5(17,18)19)3(13,14)7(23,24)32(28,29)27-33(30,31)8(25,26)4(15,16)2(11,12)6(20,21)22;/q2*-1;+2 |
| InChIKey | OVBVNDBYFXZZEY-UHFFFAOYSA-N |
| XLogP | 9.74 |
| TPSA | 164.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1223.92 |
| LogP ≤ 5 | 9.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|