C4H2F9O2PS — CID 152575055
1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonylphosphane (PubChem CID 152575055) has the molecular formula C4H2F9O2PS and a molecular weight of 316.08 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonylphosphane.
| Compound Name | 1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonylphosphane |
|---|---|
| PubChem CID | 152575055 |
| Molecular Formula | C4H2F9O2PS |
| Molecular Weight | 316.08 g/mol |
| Exact Mass | 315.94 |
| IUPAC Name | 1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonylphosphane |
| SMILES | O=S(=O)(P)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C4H2F9O2PS/c5-1(6,3(9,10)11)2(7,8)4(12,13)17(14,15)16/h16H2 |
| InChIKey | YSHLBHKDGDOSDE-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.08 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|