C4H2F10LiNO4S2 — CID 173065496
lithium;hydride;N-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)sulfamoyl fluoride (PubChem CID 173065496) has the molecular formula C4H2F10LiNO4S2 and a molecular weight of 389.12 g/mol. Its IUPAC name is lithium;hydride;N-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)sulfamoyl fluoride.
| Compound Name | lithium;hydride;N-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)sulfamoyl fluoride |
|---|---|
| PubChem CID | 173065496 |
| Molecular Formula | C4H2F10LiNO4S2 |
| Molecular Weight | 389.12 g/mol |
| Exact Mass | 388.94 |
| IUPAC Name | lithium;hydride;N-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)sulfamoyl fluoride |
| SMILES | O=S(=O)(F)NS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.[H-].[Li+] |
| InChI | InChI=1S/C4HF10NO4S2.Li.H/c5-1(6,3(9,10)11)2(7,8)4(12,13)20(16,17)15-21(14,18)19;;/h15H;;/q;+1;-1 |
| InChIKey | KHEIVVIJWQQRFO-UHFFFAOYSA-N |
| XLogP | -1.34 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.12 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|