C10HF14NO4S2 — CID 88939934
2,3,4,5,6-pentafluoro-N-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)benzenesulfonamide (PubChem CID 88939934) has the molecular formula C10HF14NO4S2 and a molecular weight of 529.23 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluoro-N-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)benzenesulfonamide.
| Compound Name | 2,3,4,5,6-pentafluoro-N-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)benzenesulfonamide |
|---|---|
| PubChem CID | 88939934 |
| Molecular Formula | C10HF14NO4S2 |
| Molecular Weight | 529.23 g/mol |
| Exact Mass | 528.91 |
| IUPAC Name | 2,3,4,5,6-pentafluoro-N-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)benzenesulfonamide |
| SMILES | O=S(=O)(NS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C10HF14NO4S2/c11-1-2(12)4(14)6(5(15)3(1)13)30(26,27)25-31(28,29)10(23,24)8(18,19)7(16,17)9(20,21)22/h25H |
| InChIKey | PMCNMNQMEXDWMH-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.23 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|