C5H3F11N2O2S — CID 155317025
1,1,2,2,3,3,4,4,5,5,5-undecafluoropentane-1-sulfonohydrazide (PubChem CID 155317025) has the molecular formula C5H3F11N2O2S and a molecular weight of 364.14 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,5,5-undecafluoropentane-1-sulfonohydrazide.
| Compound Name | 1,1,2,2,3,3,4,4,5,5,5-undecafluoropentane-1-sulfonohydrazide |
|---|---|
| PubChem CID | 155317025 |
| Molecular Formula | C5H3F11N2O2S |
| Molecular Weight | 364.14 g/mol |
| Exact Mass | 363.97 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,5,5-undecafluoropentane-1-sulfonohydrazide |
| SMILES | NNS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C5H3F11N2O2S/c6-1(7,2(8,9)4(12,13)14)3(10,11)5(15,16)21(19,20)18-17/h18H,17H2 |
| InChIKey | KLJYDAIBLNBUPW-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.14 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|