C9H11F13NNaO2SSi — CID 173151402
sodium;hydride;1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluoro-N-trimethylsilylhexane-1-sulfonamide (PubChem CID 173151402) has the molecular formula C9H11F13NNaO2SSi and a molecular weight of 495.31 g/mol. Its IUPAC name is sodium;hydride;1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluoro-N-trimethylsilylhexane-1-sulfonamide.
| Compound Name | sodium;hydride;1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluoro-N-trimethylsilylhexane-1-sulfonamide |
|---|---|
| PubChem CID | 173151402 |
| Molecular Formula | C9H11F13NNaO2SSi |
| Molecular Weight | 495.31 g/mol |
| Exact Mass | 495.00 |
| IUPAC Name | sodium;hydride;1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluoro-N-trimethylsilylhexane-1-sulfonamide |
| SMILES | C[Si](C)(C)NS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.[H-].[Na+] |
| InChI | InChI=1S/C9H10F13NO2SSi.Na.H/c1-27(2,3)23-26(24,25)9(21,22)7(16,17)5(12,13)4(10,11)6(14,15)8(18,19)20;;/h23H,1-3H3;;/q;+1;-1 |
| InChIKey | BCWWGQJJJARZFE-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.31 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|