C9HF17N2O2S — CID 100975647
N-cyano-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonamide (PubChem CID 100975647) has the molecular formula C9HF17N2O2S and a molecular weight of 524.15 g/mol. Its IUPAC name is N-cyano-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonamide.
| Compound Name | N-cyano-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonamide |
|---|---|
| PubChem CID | 100975647 |
| Molecular Formula | C9HF17N2O2S |
| Molecular Weight | 524.15 g/mol |
| Exact Mass | 523.95 |
| IUPAC Name | N-cyano-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonamide |
| SMILES | N#CNS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9HF17N2O2S/c10-2(11,4(14,15)6(18,19)8(22,23)24)3(12,13)5(16,17)7(20,21)9(25,26)31(29,30)28-1-27/h28H |
| InChIKey | DFPPZRLDHVYIIM-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.15 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|