C16H20F17N3O2S — CID 90962469
N-[6-amino-4-(2-aminoethyl)hexyl]-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonamide (PubChem CID 90962469) has the molecular formula C16H20F17N3O2S and a molecular weight of 641.39 g/mol. Its IUPAC name is N-[6-amino-4-(2-aminoethyl)hexyl]-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonamide.
| Compound Name | N-[6-amino-4-(2-aminoethyl)hexyl]-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonamide |
|---|---|
| PubChem CID | 90962469 |
| Molecular Formula | C16H20F17N3O2S |
| Molecular Weight | 641.39 g/mol |
| Exact Mass | 641.10 |
| IUPAC Name | N-[6-amino-4-(2-aminoethyl)hexyl]-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonamide |
| SMILES | NCCC(CCN)CCCNS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H20F17N3O2S/c17-9(18,11(21,22)13(25,26)15(29,30)31)10(19,20)12(23,24)14(27,28)16(32,33)39(37,38)36-7-1-2-8(3-5-34)4-6-35/h8,36H,1-7,34-35H2 |
| InChIKey | GJSQRUVYAWKAOY-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.39 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|