C16H19F15N2O2 — CID 87965191
N-[4-(2-aminoethyl)-6-hydroxyhexyl]-2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanamide (PubChem CID 87965191) has the molecular formula C16H19F15N2O2 and a molecular weight of 556.31 g/mol. Its IUPAC name is N-[4-(2-aminoethyl)-6-hydroxyhexyl]-2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanamide.
| Compound Name | N-[4-(2-aminoethyl)-6-hydroxyhexyl]-2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanamide |
|---|---|
| PubChem CID | 87965191 |
| Molecular Formula | C16H19F15N2O2 |
| Molecular Weight | 556.31 g/mol |
| Exact Mass | 556.12 |
| IUPAC Name | N-[4-(2-aminoethyl)-6-hydroxyhexyl]-2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanamide |
| SMILES | NCCC(CCO)CCCNC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H19F15N2O2/c17-10(18,9(35)33-6-1-2-8(3-5-32)4-7-34)11(19,20)12(21,22)13(23,24)14(25,26)15(27,28)16(29,30)31/h8,34H,1-7,32H2,(H,33,35) |
| InChIKey | IWQOXWJSKJCPFL-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.31 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|