C11HF15O3S — CID 139920698
2,3,4,5-tetrafluoro-6-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentyl)benzenesulfonic acid (PubChem CID 139920698) has the molecular formula C11HF15O3S and a molecular weight of 498.16 g/mol. Its IUPAC name is 2,3,4,5-tetrafluoro-6-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentyl)benzenesulfonic acid.
| Compound Name | 2,3,4,5-tetrafluoro-6-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentyl)benzenesulfonic acid |
|---|---|
| PubChem CID | 139920698 |
| Molecular Formula | C11HF15O3S |
| Molecular Weight | 498.16 g/mol |
| Exact Mass | 497.94 |
| IUPAC Name | 2,3,4,5-tetrafluoro-6-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentyl)benzenesulfonic acid |
| SMILES | O=S(=O)(O)c1c(F)c(F)c(F)c(F)c1C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11HF15O3S/c12-2-1(6(30(27,28)29)5(15)4(14)3(2)13)7(16,17)8(18,19)9(20,21)10(22,23)11(24,25)26/h(H,27,28,29) |
| InChIKey | YYRUTOYYKPYKCL-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.16 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|