C17HF27O — CID 139749065
2,3,4-trifluoro-5-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecyl)-6-(trifluoromethyl)phenol (PubChem CID 139749065) has the molecular formula C17HF27O and a molecular weight of 734.14 g/mol. Its IUPAC name is 2,3,4-trifluoro-5-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecyl)-6-(trifluoromethyl)phenol.
| Compound Name | 2,3,4-trifluoro-5-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecyl)-6-(trifluoromethyl)phenol |
|---|---|
| PubChem CID | 139749065 |
| Molecular Formula | C17HF27O |
| Molecular Weight | 734.14 g/mol |
| Exact Mass | 733.96 |
| IUPAC Name | 2,3,4-trifluoro-5-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecyl)-6-(trifluoromethyl)phenol |
| SMILES | Oc1c(F)c(F)c(F)c(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1C(F)(F)F |
| InChI | InChI=1S/C17HF27O/c18-3-1(2(8(23,24)25)6(45)5(20)4(3)19)7(21,22)9(26,27)10(28,29)11(30,31)12(32,33)13(34,35)14(36,37)15(38,39)16(40,41)17(42,43)44/h45H |
| InChIKey | FNAQAZSUWKTLBJ-UHFFFAOYSA-N |
| XLogP | 9.56 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.14 |
| LogP ≤ 5 | 9.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|