C8HF9O — CID 139749075
2,3,4,5-tetrafluoro-6-(1,1,2,2,2-pentafluoroethyl)phenol (PubChem CID 139749075) has the molecular formula C8HF9O and a molecular weight of 284.08 g/mol. Its IUPAC name is 2,3,4,5-tetrafluoro-6-(1,1,2,2,2-pentafluoroethyl)phenol.
| Compound Name | 2,3,4,5-tetrafluoro-6-(1,1,2,2,2-pentafluoroethyl)phenol |
|---|---|
| PubChem CID | 139749075 |
| Molecular Formula | C8HF9O |
| Molecular Weight | 284.08 g/mol |
| Exact Mass | 283.99 |
| IUPAC Name | 2,3,4,5-tetrafluoro-6-(1,1,2,2,2-pentafluoroethyl)phenol |
| SMILES | Oc1c(F)c(F)c(F)c(F)c1C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8HF9O/c9-2-1(7(13,14)8(15,16)17)6(18)5(12)4(11)3(2)10/h18H |
| InChIKey | GUYNQBXVTKIQAE-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.08 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|