C9H2F8O3 — CID 14687563
2,2,3,3-tetrafluoro-3-(2,3,4,5-tetrafluoro-6-hydroxyphenyl)propanoic acid (PubChem CID 14687563) has the molecular formula C9H2F8O3 and a molecular weight of 310.10 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-3-(2,3,4,5-tetrafluoro-6-hydroxyphenyl)propanoic acid.
| Compound Name | 2,2,3,3-tetrafluoro-3-(2,3,4,5-tetrafluoro-6-hydroxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 14687563 |
| Molecular Formula | C9H2F8O3 |
| Molecular Weight | 310.10 g/mol |
| Exact Mass | 309.99 |
| IUPAC Name | 2,2,3,3-tetrafluoro-3-(2,3,4,5-tetrafluoro-6-hydroxyphenyl)propanoic acid |
| SMILES | O=C(O)C(F)(F)C(F)(F)c1c(O)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C9H2F8O3/c10-2-1(6(18)5(13)4(12)3(2)11)8(14,15)9(16,17)7(19)20/h18H,(H,19,20) |
| InChIKey | FUWJYWUQWIRHCP-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.10 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|