C15H7F5O7 — CID 158155753
benzene-1,3,5-tricarboxylic acid;2,3,4,5,6-pentafluorophenol (PubChem CID 158155753) has the molecular formula C15H7F5O7 and a molecular weight of 394.20 g/mol. Its IUPAC name is benzene-1,3,5-tricarboxylic acid;2,3,4,5,6-pentafluorophenol.
| Compound Name | benzene-1,3,5-tricarboxylic acid;2,3,4,5,6-pentafluorophenol |
|---|---|
| PubChem CID | 158155753 |
| Molecular Formula | C15H7F5O7 |
| Molecular Weight | 394.20 g/mol |
| Exact Mass | 394.01 |
| IUPAC Name | benzene-1,3,5-tricarboxylic acid;2,3,4,5,6-pentafluorophenol |
| SMILES | O=C(O)c1cc(C(=O)O)cc(C(=O)O)c1.Oc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C9H6O6.C6HF5O/c10-7(11)4-1-5(8(12)13)3-6(2-4)9(14)15;7-1-2(8)4(10)6(12)5(11)3(1)9/h1-3H,(H,10,11)(H,12,13)(H,14,15);12H |
| InChIKey | FVQXAMFXARXPKY-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 132.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.20 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|