C14H5F5O4 — CID 177395846
5-(2,3,4,5,6-pentafluorophenyl)benzene-1,3-dicarboxylic acid (PubChem CID 177395846) has the molecular formula C14H5F5O4 and a molecular weight of 332.18 g/mol. Its IUPAC name is 5-(2,3,4,5,6-pentafluorophenyl)benzene-1,3-dicarboxylic acid.
| Compound Name | 5-(2,3,4,5,6-pentafluorophenyl)benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 177395846 |
| Molecular Formula | C14H5F5O4 |
| Molecular Weight | 332.18 g/mol |
| Exact Mass | 332.01 |
| IUPAC Name | 5-(2,3,4,5,6-pentafluorophenyl)benzene-1,3-dicarboxylic acid |
| SMILES | O=C(O)c1cc(C(=O)O)cc(-c2c(F)c(F)c(F)c(F)c2F)c1 |
| InChI | InChI=1S/C14H5F5O4/c15-8-7(9(16)11(18)12(19)10(8)17)4-1-5(13(20)21)3-6(2-4)14(22)23/h1-3H,(H,20,21)(H,22,23) |
| InChIKey | WQZMGYMIEWCQLA-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.18 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|